EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H39NO9P |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 492.522 |
| Monoisotopic Mass (excl. R groups) | 492.23624 |
| SMILES | *OC[C@H](COP(=O)([O-])OC[C@H]([NH3+])C(=O)[O-])O* |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysophosphatidylserine 16:2(1−) (CHEBI:72407) is a lysophosphatidylserine(1−) (CHEBI:68497) |
| lysophosphatidylserine 16:2(1−) (CHEBI:72407) is conjugate base of lysophosphatidylserine 16:2 (CHEBI:189054) |
| Incoming Relation(s) |
| lysophosphatidylserine 16:2 (CHEBI:189054) is conjugate acid of lysophosphatidylserine 16:2(1−) (CHEBI:72407) |
| Synonyms | Source |
|---|---|
| LPS 16:2 | SUBMITTER |
| LPS(16:2) | SUBMITTER |
| lysophosphatidylserine(16:2) | SUBMITTER |
| Lyso-PS(16:2) | SUBMITTER |