EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H43NO7P |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 476.566 |
| Monoisotopic Mass (excl. R groups) | 476.27771 |
| SMILES | *OC[C@]([H])(COP(=O)([O-])OCC[NH3+])O* |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysophosphatidylethanolamine zwitterion 18:2 (CHEBI:72389) is a lysophosphatidylethanolamine zwitterion (CHEBI:67274) |
| lysophosphatidylethanolamine zwitterion 18:2 (CHEBI:72389) is tautomer of lysophosphatidylethanolamine 18:2 (CHEBI:91296) |
| Incoming Relation(s) |
| 1-linoleoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:133732) is a lysophosphatidylethanolamine zwitterion 18:2 (CHEBI:72389) |
| 2-linoleoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:76090) is a lysophosphatidylethanolamine zwitterion 18:2 (CHEBI:72389) |
| lysophosphatidylethanolamine 18:2 (CHEBI:91296) is tautomer of lysophosphatidylethanolamine zwitterion 18:2 (CHEBI:72389) |
| Synonyms | Source |
|---|---|
| LPE 18:2 | SUBMITTER |
| LPE(18:2) | SUBMITTER |
| lysophosphatidylethanolamine (18:2) | SUBMITTER |
| lysophosphatidylethanolamine zwitterion (18:2) | ChEBI |