EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H43NO7P |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 452.545 |
| Monoisotopic Mass (excl. R groups) | 452.27771 |
| SMILES | *OC[C@]([H])(COP(=O)([O-])OCC[NH3+])O* |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysophosphatidylethanolamine zwitterion 16:0 (CHEBI:72384) is a lysophosphatidylethanolamine zwitterion (CHEBI:67274) |
| lysophosphatidylethanolamine zwitterion 16:0 (CHEBI:72384) is tautomer of lysophosphatidylethanolamine 16:0 (CHEBI:90452) |
| Incoming Relation(s) |
| 1-hexadecanoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:73004) is a lysophosphatidylethanolamine zwitterion 16:0 (CHEBI:72384) |
| 2-hexadecanoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:132926) is a lysophosphatidylethanolamine zwitterion 16:0 (CHEBI:72384) |
| lysophosphatidylethanolamine 16:0 (CHEBI:90452) is tautomer of lysophosphatidylethanolamine zwitterion 16:0 (CHEBI:72384) |
| Synonyms | Source |
|---|---|
| LPE 16:0 | SUBMITTER |
| LPE(16:0) | SUBMITTER |
| lysophosphatidylethanolamine (16:0) | SUBMITTER |