EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N5O2.C7H6O2 |
| Net Charge | 0 |
| Average Mass | 461.522 |
| Monoisotopic Mass | 461.20630 |
| SMILES | Cn1c(=O)cc(N2CCC[C@@H](N)C2)n(Cc2ccccc2C#N)c1=O.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C18H21N5O2.C7H6O2/c1-21-17(24)9-16(22-8-4-7-15(20)12-22)23(18(21)25)11-14-6-3-2-5-13(14)10-19;8-7(9)6-4-2-1-3-5-6/h2-3,5-6,9,15H,4,7-8,11-12,20H2,1H3;1-5H,(H,8,9)/t15-;/m1./s1 |
| InChIKey | KEJICOXJTRHYAK-XFULWGLBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor An EC 3.4.14.* (dipeptidyl- and tripeptidyl-peptidases) inhibitor that specifically inhibits dipeptidyl peptidase-4 (EC 3.4.14.5). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alogliptin benzoate (CHEBI:72324) has part alogliptin(1+) (CHEBI:72326) |
| alogliptin benzoate (CHEBI:72324) has role EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor (CHEBI:68612) |
| alogliptin benzoate (CHEBI:72324) has role hypoglycemic agent (CHEBI:35526) |
| alogliptin benzoate (CHEBI:72324) is a benzoate salt (CHEBI:72325) |
| IUPAC Names |
|---|
| 2-({6-[(3R)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl}methyl)benzonitrile benzoate |
| (3R)-1-[3-(2-cyanobenzyl)-1-methyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl]piperidin-3-aminium benzoate |
| Synonyms | Source |
|---|---|
| 6-((3R)-3-aminopiperidin-1-yl)-1-(2-cyanobenzyl)-3-methylpyrimidin-2,4(1H,3H)-dione monobenzoate | ChemIDplus |
| alogliptin monobenzoate | ChEBI |
| SYR-322 | ChemIDplus |
| SYR 322 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Nesina | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D06553 | KEGG DRUG |
| EP1970063 | Patent |
| US2007066635 | Patent |
| WO2010109468 | Patent |
| EP1586571 | Patent |
| Alogliptin | Wikipedia |
| WO2011141903 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12413070 | Reaxys |
| CAS:850649-62-6 | KEGG DRUG |
| CAS:850649-62-6 | ChemIDplus |
| Citations |
|---|