EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21N5O2 |
| Net Charge | 0 |
| Average Mass | 339.399 |
| Monoisotopic Mass | 339.16952 |
| SMILES | Cn1c(=O)cc(N2CCC[C@@H](N)C2)n(Cc2ccccc2C#N)c1=O |
| InChI | InChI=1S/C18H21N5O2/c1-21-17(24)9-16(22-8-4-7-15(20)12-22)23(18(21)25)11-14-6-3-2-5-13(14)10-19/h2-3,5-6,9,15H,4,7-8,11-12,20H2,1H3/t15-/m1/s1 |
| InChIKey | ZSBOMTDTBDDKMP-OAHLLOKOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor An EC 3.4.14.* (dipeptidyl- and tripeptidyl-peptidases) inhibitor that specifically inhibits dipeptidyl peptidase-4 (EC 3.4.14.5). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alogliptin (CHEBI:72323) has role EC 3.4.14.5 (dipeptidyl-peptidase IV) inhibitor (CHEBI:68612) |
| alogliptin (CHEBI:72323) has role hypoglycemic agent (CHEBI:35526) |
| alogliptin (CHEBI:72323) is a benzenes (CHEBI:22712) |
| alogliptin (CHEBI:72323) is a nitrile (CHEBI:18379) |
| alogliptin (CHEBI:72323) is a organic molecular entity (CHEBI:50860) |
| alogliptin (CHEBI:72323) is a piperidines (CHEBI:26151) |
| alogliptin (CHEBI:72323) is a primary amino compound (CHEBI:50994) |
| alogliptin (CHEBI:72323) is a pyrimidines (CHEBI:39447) |
| alogliptin (CHEBI:72323) is conjugate base of alogliptin(1+) (CHEBI:72326) |
| Incoming Relation(s) |
| alogliptin(1+) (CHEBI:72326) is conjugate acid of alogliptin (CHEBI:72323) |
| IUPAC Name |
|---|
| 2-({6-[(3R)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl}methyl)benzonitrile |
| INNs | Source |
|---|---|
| alogliptin | ChemIDplus |
| alogliptina | WHO MedNet |
| alogliptine | WHO MedNet |
| alogliptinum | WHO MedNet |
| Manual Xrefs | Databases |
|---|---|
| 4340 | DrugCentral |
| Alogliptin | Wikipedia |
| EP1970063 | Patent |
| US2007066635 | Patent |
| US2009275750 | Patent |
| WO2008028914 | Patent |
| WO2009022009 | Patent |
| WO2010072680 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10587993 | Reaxys |
| CAS:850649-61-5 | ChemIDplus |
| Citations |
|---|