EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H48O7 |
| Net Charge | 0 |
| Average Mass | 556.740 |
| Monoisotopic Mass | 556.34000 |
| SMILES | [H][C@@]12CC(=O)/C(=C(C)\C=C\C=C(/C)C(/C=C/C(C)(C)O)OC)[C@@]1(C)CC[C@]1([H])[C@]2(C)CC[C@@H](OC(C)=O)[C@]1(C)C(=O)O |
| InChI | InChI=1S/C33H48O7/c1-20(24(39-9)13-16-30(4,5)38)11-10-12-21(2)28-23(35)19-26-31(6)18-15-27(40-22(3)34)33(8,29(36)37)25(31)14-17-32(26,28)7/h10-13,16,24-27,38H,14-15,17-19H2,1-9H3,(H,36,37)/b12-10+,16-13+,20-11+,28-21+/t24?,25-,26+,27-,31+,32+,33-/m1/s1 |
| InChIKey | MBQOCAYHVGZDCH-HGJCQRRPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| globostellatic acid B (CHEBI:72304) has role antineoplastic agent (CHEBI:35610) |
| globostellatic acid B (CHEBI:72304) has role metabolite (CHEBI:25212) |
| globostellatic acid B (CHEBI:72304) is a acetate ester (CHEBI:47622) |
| globostellatic acid B (CHEBI:72304) is a enone (CHEBI:51689) |
| globostellatic acid B (CHEBI:72304) is a ether (CHEBI:25698) |
| globostellatic acid B (CHEBI:72304) is a oxo monocarboxylic acid (CHEBI:35871) |
| globostellatic acid B (CHEBI:72304) is a tricyclic triterpenoid (CHEBI:52340) |
| globostellatic acid B (CHEBI:72304) is conjugate acid of globostellatate B(1−) (CHEBI:72303) |
| Incoming Relation(s) |
| globostellatate B(1−) (CHEBI:72303) is conjugate base of globostellatic acid B (CHEBI:72304) |
| IUPAC Name |
|---|
| (3Z,3aS,5aR,6R,7R,9aR,9bS)-7-(acetyloxy)-3-[(3E,5E,8E)-10-hydroxy-7-methoxy-6,10-dimethylundeca-3,5,8-trien-2-ylidene]-3a,6,9a-trimethyl-2-oxododecahydro-1H-cyclopenta[a]naphthalene-6-carboxylic acid |