EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44O7 |
| Net Charge | 0 |
| Average Mass | 540.697 |
| Monoisotopic Mass | 540.30870 |
| SMILES | [H][C@@]12CC(=O)/C(=C(/C)C(=O)/C=C/C(C)=C/C=C/C(C)(C)O)[C@@]1(C)CC[C@]1([H])[C@]2(C)CC[C@@H](OC(C)=O)[C@]1(C)C(=O)O |
| InChI | InChI=1S/C32H44O7/c1-19(10-9-15-29(4,5)38)11-12-22(34)20(2)27-23(35)18-25-30(6)17-14-26(39-21(3)33)32(8,28(36)37)24(30)13-16-31(25,27)7/h9-12,15,24-26,38H,13-14,16-18H2,1-8H3,(H,36,37)/b12-11+,15-9+,19-10+,27-20+/t24-,25+,26-,30+,31+,32-/m1/s1 |
| InChIKey | FCEBMUDWBVZUAU-JZOYBAOCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| globostellatic acid A (CHEBI:72301) has role antineoplastic agent (CHEBI:35610) |
| globostellatic acid A (CHEBI:72301) has role metabolite (CHEBI:25212) |
| globostellatic acid A (CHEBI:72301) is a acetate ester (CHEBI:47622) |
| globostellatic acid A (CHEBI:72301) is a dioxo monocarboxylic acid (CHEBI:35951) |
| globostellatic acid A (CHEBI:72301) is a enone (CHEBI:51689) |
| globostellatic acid A (CHEBI:72301) is a tricyclic triterpenoid (CHEBI:52340) |
| globostellatic acid A (CHEBI:72301) is conjugate acid of globostellatate A(1−) (CHEBI:72300) |
| Incoming Relation(s) |
| globostellatate A(1−) (CHEBI:72300) is conjugate base of globostellatic acid A (CHEBI:72301) |
| IUPAC Name |
|---|
| (3Z,3aS,5aR,6R,7R,9aR,9bS)-7-(acetyloxy)-3-[(4E,6E,8E)-10-hydroxy-6,10-dimethyl-3-oxoundeca-4,6,8-trien-2-ylidene]-3a,6,9a-trimethyl-2-oxododecahydro-1H-cyclopenta[a]naphthalene-6-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8529059 | Reaxys |