EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H37F6N3O2.CH4O3S |
| Net Charge | 0 |
| Average Mass | 789.839 |
| Monoisotopic Mass | 789.26711 |
| SMILES | CS(=O)(=O)O.O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C39H37F6N3O2.CH4O3S/c40-38(41,42)25-46-36(50)37(33-13-5-3-10-30(33)31-11-4-6-14-34(31)37)21-7-8-22-48-23-19-28(20-24-48)47-35(49)32-12-2-1-9-29(32)26-15-17-27(18-16-26)39(43,44)45;1-5(2,3)4/h1-6,9-18,28H,7-8,19-25H2,(H,46,50)(H,47,49);1H3,(H,2,3,4) |
| InChIKey | QKVKOFVWUHNEBX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | MTP inhibitor An inhibitor that interferes with the action of MTP. |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lomitapide mesylate (CHEBI:72299) has part lomitapide(1+) (CHEBI:72302) |
| lomitapide mesylate (CHEBI:72299) has role anticholesteremic drug (CHEBI:35821) |
| lomitapide mesylate (CHEBI:72299) has role MTP inhibitor (CHEBI:72298) |
| lomitapide mesylate (CHEBI:72299) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Names |
|---|
| N-(2,2,2-trifluoroethyl)-9-{4-[4-({[4'-(trifluoromethyl)biphenyl-2-yl]carbonyl}amino)piperidin-1-yl]butyl}-9H-fluorene-9-carboxamide methanesulfonate |
| 1-(4-{9-[(2,2,2-trifluoroethyl)carbamoyl]-9H-fluoren-9-yl}butyl)-4-({[4'-(trifluoromethyl)biphenyl-2-yl]carbonyl}amino)piperidinium methanesulfonate |
| Synonyms | Source |
|---|---|
| BMS-201038 | ChemIDplus |
| BMS-201038-04 | ChemIDplus |
| AEGR-733 | ChemIDplus |
| Brand Names | Source |
|---|---|
| lomitapide methanesulfonate | ChEBI |
| Juxtapid | ChemIDplus |
| lomitapide monomesylate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D09638 | KEGG DRUG |
| WO2005087234 | Patent |
| WO2007047722 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14506420 | Reaxys |
| CAS:202914-84-9 | KEGG DRUG |
| CAS:202914-84-9 | ChemIDplus |
| Citations |
|---|