EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H37F6N3O2 |
| Net Charge | 0 |
| Average Mass | 693.732 |
| Monoisotopic Mass | 693.27900 |
| SMILES | O=C(NC1CCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C39H37F6N3O2/c40-38(41,42)25-46-36(50)37(33-13-5-3-10-30(33)31-11-4-6-14-34(31)37)21-7-8-22-48-23-19-28(20-24-48)47-35(49)32-12-2-1-9-29(32)26-15-17-27(18-16-26)39(43,44)45/h1-6,9-18,28H,7-8,19-25H2,(H,46,50)(H,47,49) |
| InChIKey | MBBCVAKAJPKAKM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | MTP inhibitor An inhibitor that interferes with the action of MTP. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lomitapide (CHEBI:72297) has role anticholesteremic drug (CHEBI:35821) |
| lomitapide (CHEBI:72297) has role MTP inhibitor (CHEBI:72298) |
| lomitapide (CHEBI:72297) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| lomitapide (CHEBI:72297) is a benzamides (CHEBI:22702) |
| lomitapide (CHEBI:72297) is a fluorenes (CHEBI:24059) |
| lomitapide (CHEBI:72297) is a piperidines (CHEBI:26151) |
| lomitapide (CHEBI:72297) is conjugate base of lomitapide(1+) (CHEBI:72302) |
| Incoming Relation(s) |
| lomitapide(1+) (CHEBI:72302) is conjugate acid of lomitapide (CHEBI:72297) |
| IUPAC Name |
|---|
| N-(2,2,2-trifluoroethyl)-9-{4-[4-({[4'-(trifluoromethyl)biphenyl-2-yl]carbonyl}amino)piperidin-1-yl]butyl}-9H-fluorene-9-carboxamide |
| INNs | Source |
|---|---|
| lomitapide | KEGG DRUG |
| lomitapida | WHO MedNet |
| lomitapidum | WHO MedNet |
| lomitapide | WHO MedNet |
| Synonyms | Source |
|---|---|
| AEGR 733 | ChemIDplus |
| BMS 201038 | ChemIDplus |
| BMS201038 | DrugCentral |
| BMS-201038 | DrugCentral |
| Juxtapid | DrugCentral |
| Lojuxta | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| D09637 | KEGG DRUG |
| US2008161279 | Patent |
| US2003162788 | Patent |
| Lomitapide | Wikipedia |
| US2011288064 | Patent |
| US2011288110 | Patent |
| US2012071458 | Patent |
| US2012035204 | Patent |
| US2010273829 | Patent |
| 4721 | DrugCentral |
| DB08827 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13754976 | Reaxys |
| CAS:182431-12-5 | KEGG DRUG |
| CAS:182431-12-5 | ChemIDplus |
| Citations |
|---|