EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H25N5O4 |
| Net Charge | 0 |
| Average Mass | 459.506 |
| Monoisotopic Mass | 459.19065 |
| SMILES | COc1ccc(-n2nc(C(N)=O)c3c2C(=O)N(c2ccc(N4CCCCC4=O)cc2)CC3)cc1 |
| InChI | InChI=1S/C25H25N5O4/c1-34-19-11-9-18(10-12-19)30-23-20(22(27-30)24(26)32)13-15-29(25(23)33)17-7-5-16(6-8-17)28-14-3-2-4-21(28)31/h5-12H,2-4,13-15H2,1H3,(H2,26,32) |
| InChIKey | QNZCBYKSOIHPEH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 3.4.21.6 (coagulation factor Xa) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of coagulation factor Xa (EC 3.4.21.6). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hepatoprotective agent Any compound that is able to prevent damage to the liver. anticoagulant An agent that prevents blood clotting. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apixaban (CHEBI:72296) has role anti-anaemic agent (CHEBI:75835) |
| apixaban (CHEBI:72296) has role anti-arrhythmia drug (CHEBI:38070) |
| apixaban (CHEBI:72296) has role anticoagulant (CHEBI:50249) |
| apixaban (CHEBI:72296) has role antineoplastic agent (CHEBI:35610) |
| apixaban (CHEBI:72296) has role antiviral agent (CHEBI:22587) |
| apixaban (CHEBI:72296) has role cardiovascular drug (CHEBI:35554) |
| apixaban (CHEBI:72296) has role EC 3.4.21.6 (coagulation factor Xa) inhibitor (CHEBI:68581) |
| apixaban (CHEBI:72296) has role hepatoprotective agent (CHEBI:62868) |
| apixaban (CHEBI:72296) is a aromatic ether (CHEBI:35618) |
| apixaban (CHEBI:72296) is a lactam (CHEBI:24995) |
| apixaban (CHEBI:72296) is a piperidones (CHEBI:48589) |
| apixaban (CHEBI:72296) is a pyrazolopyridine (CHEBI:46699) |
| IUPAC Name |
|---|
| 1-(4-methoxyphenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5,6,7-tetrahydro-1H-pyrazolo[3,4-c]pyridine-3-carboxamide |
| INNs | Source |
|---|---|
| apixaban | KEGG DRUG |
| apixaban | WHO MedNet |
| apixabán | WHO MedNet |
| apixabanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BMS-562247 | DrugBank |
| BMS 562247-01 | ChemIDplus |
| BMS-562247-01 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Apixaban accord | ChEMBL |
| Eliquis | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| Apixaban | Wikipedia |
| D03213 | KEGG DRUG |
| DB06605 | DrugBank |
| GG2 | PDBeChem |
| US2007259913 | Patent |
| WO2007022165 | Patent |
| WO2008031782 | Patent |
| WO2010030983 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11244786 | Reaxys |
| CAS:503612-47-3 | KEGG DRUG |
| CAS:503612-47-3 | ChemIDplus |
| Citations |
|---|