EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23ClFNO5 |
| Net Charge | 0 |
| Average Mass | 447.890 |
| Monoisotopic Mass | 447.12488 |
| SMILES | COc1cc2c(cc1Cc1cccc(Cl)c1F)c(=O)c(C(=O)O)cn2[C@H](CO)C(C)C |
| InChI | InChI=1S/C23H23ClFNO5/c1-12(2)19(11-27)26-10-16(23(29)30)22(28)15-8-14(20(31-3)9-18(15)26)7-13-5-4-6-17(24)21(13)25/h4-6,8-10,12,19,27H,7,11H2,1-3H3,(H,29,30)/t19-/m1/s1 |
| InChIKey | JUZYLCPPVHEVSV-LJQANCHMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| Application: | insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elvitegravir (CHEBI:72289) has role anti-HIV agent (CHEBI:64946) |
| elvitegravir (CHEBI:72289) has role antiviral agent (CHEBI:22587) |
| elvitegravir (CHEBI:72289) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| elvitegravir (CHEBI:72289) has role insulin-sensitizing drug (CHEBI:50864) |
| elvitegravir (CHEBI:72289) is a aromatic ether (CHEBI:35618) |
| elvitegravir (CHEBI:72289) is a monochlorobenzenes (CHEBI:83403) |
| elvitegravir (CHEBI:72289) is a organic molecular entity (CHEBI:50860) |
| elvitegravir (CHEBI:72289) is a organofluorine compound (CHEBI:37143) |
| elvitegravir (CHEBI:72289) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| elvitegravir (CHEBI:72289) is a quinolines (CHEBI:26513) |
| elvitegravir (CHEBI:72289) is a quinolone (CHEBI:23765) |
| Incoming Relation(s) |
| Genvoya (CHEBI:90922) has part elvitegravir (CHEBI:72289) |
| IUPAC Name |
|---|
| 6-(3-chloro-2-fluorobenzyl)-1-[(2S)-1-hydroxy-3-methylbutan-2-yl]-7-methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| INNs | Source |
|---|---|
| elvitegravir | WHO MedNet |
| elvitegravir | WHO MedNet |
| elvitégravir | WHO MedNet |
| elvitegravirum | WHO MedNet |
| Synonyms | Source |
|---|---|
| GS 9137 | ChemIDplus |
| GS-9137 | KEGG DRUG |
| Brand Names | Source |
|---|---|
| Elvitegravir component of genvoya | ChEMBL |
| Elvitegravir component of stribild | ChEMBL |
| Elvitegravir component of vitekta | ChEMBL |
| Vitekta | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4300 | DrugCentral |
| D06677 | KEGG DRUG |
| Elvitegravir | Wikipedia |
| LSM-5647 | LINCS |
| WO2009089263 | Patent |
| WO2010137032 | Patent |
| WO2011004389 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10609264 | Reaxys |
| CAS:697761-98-1 | ChemIDplus |
| CAS:697761-98-1 | KEGG DRUG |
| Citations |
|---|