EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H41NO2 |
| Net Charge | 0 |
| Average Mass | 327.553 |
| Monoisotopic Mass | 327.31373 |
| SMILES | CCCCCCCCCCCCCCC/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C20H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(21)18-22/h16-17,19-20,22-23H,2-15,18,21H2,1H3/b17-16+/t19-,20+/m0/s1 |
| InChIKey | HTJSZHKGNMXZJN-YIVRLKKSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C20 sphingosine (CHEBI:71982) has role mouse metabolite (CHEBI:75771) |
| C20 sphingosine (CHEBI:71982) is a aminodiol (CHEBI:22501) |
| C20 sphingosine (CHEBI:71982) is a sphingoid (CHEBI:35785) |
| C20 sphingosine (CHEBI:71982) is conjugate base of C20 sphingosine(1+) (CHEBI:71983) |
| Incoming Relation(s) |
| N-acylicosasphingosine-1-phosphocholine (CHEBI:82901) has functional parent C20 sphingosine (CHEBI:71982) |
| C20 ceramide (CHEBI:71986) has functional parent C20 sphingosine (CHEBI:71982) |
| β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1')-N-acylicosasphingosine (CHEBI:82989) has functional parent C20 sphingosine (CHEBI:71982) |
| β-D-glucosyl-(1↔1')-N-acylicosasphingosine (CHEBI:82988) has functional parent C20 sphingosine (CHEBI:71982) |
| C20 sphingosine(1+) (CHEBI:71983) is conjugate acid of C20 sphingosine (CHEBI:71982) |
| IUPAC Name |
|---|
| (2S,3R,4E)-2-aminoicos-4-ene-1,3-diol |
| Synonyms | Source |
|---|---|
| eicosasphing-4-enine | SUBMITTER |
| C20 sphing-4-enine | ChEBI |
| eicosasphingosine | ChEBI |
| icosasphing-4-enine | ChEBI |
| icosasphingosine | ChEBI |
| (2S,3R,4E)-2-aminoeicos-4-ene-1,3-diol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3547228 | Reaxys |
| Citations |
|---|