EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C53H93N7O13 |
| Net Charge | 0 |
| Average Mass | 1036.363 |
| Monoisotopic Mass | 1035.68314 |
| SMILES | [H][C@@]1(CCCCCCCCCC(C)C)CC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O1 |
| InChI | InChI=1S/C53H93N7O13/c1-30(2)20-18-16-14-13-15-17-19-21-36-28-43(61)54-37(22-23-44(62)63)47(66)55-38(24-31(3)4)48(67)57-40(26-33(7)8)51(70)60-46(35(11)12)52(71)58-41(29-45(64)65)50(69)56-39(25-32(5)6)49(68)59-42(27-34(9)10)53(72)73-36/h30-42,46H,13-29H2,1-12H3,(H,54,61)(H,55,66)(H,56,69)(H,57,67)(H,58,71)(H,59,68)(H,60,70)(H,62,63)(H,64,65)/t36-,37+,38+,39-,40-,41+,42+,46+/m1/s1 |
| InChIKey | NJGWOFRZMQRKHT-WGVNQGGSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antiviral agent A substance that destroys or inhibits replication of viruses. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| surfactin C (CHEBI:71978) has role antibacterial agent (CHEBI:33282) |
| surfactin C (CHEBI:71978) has role antifungal agent (CHEBI:35718) |
| surfactin C (CHEBI:71978) has role antineoplastic agent (CHEBI:35610) |
| surfactin C (CHEBI:71978) has role antiviral agent (CHEBI:22587) |
| surfactin C (CHEBI:71978) has role metabolite (CHEBI:25212) |
| surfactin C (CHEBI:71978) has role platelet aggregation inhibitor (CHEBI:50427) |
| surfactin C (CHEBI:71978) has role surfactant (CHEBI:35195) |
| surfactin C (CHEBI:71978) is a cyclodepsipeptide (CHEBI:35213) |
| surfactin C (CHEBI:71978) is a lipopeptide antibiotic (CHEBI:25061) |
| surfactin C (CHEBI:71978) is a macrocyclic lactone (CHEBI:63944) |
| Incoming Relation(s) |
| surfactin (CHEBI:29681) has part surfactin C (CHEBI:71978) |
| IUPAC Name |
|---|
| 3-[(3S,6R,9S,12S,15R,18S,21S,25R)-9-(carboxymethyl)-3,6,15,18-tetraisobutyl-12-isopropyl-25-(10-methylundecyl)-2,5,8,11,14,17,20,23-octaoxo-1-oxa-4,7,10,13,16,19,22-heptaazacyclopentacosan-21-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C12043 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:24730-31-2 | KEGG COMPOUND |
| CAS:24730-31-2 | ChemIDplus |
| Citations |
|---|