EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N3O16P2 |
| Net Charge | -1 |
| Average Mass | 564.310 |
| Monoisotopic Mass | 564.06373 |
| SMILES | [NH3+][C@@H]1[C@@H](O)[C@@H](OP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](n3ccc(=O)nc3=O)[C@H](O)[C@@H]2O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C15H25N3O16P2/c16-8-9(21)5(3-19)32-14(11(8)23)33-36(28,29)34-35(26,27)30-4-6-10(22)12(24)13(31-6)18-2-1-7(20)17-15(18)25/h1-2,5-6,8-14,19,21-24H,3-4,16H2,(H,26,27)(H,28,29)(H,17,20,25)/p-1/t5-,6-,8+,9-,10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | KGGAKOCPPBMRSA-SAINOKEESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-α-D-kanosamine(1−) (CHEBI:71964) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| UDP-α-D-kanosamine(1−) (CHEBI:71964) is conjugate base of UDP-α-D-kanosamine (CHEBI:32275) |
| Incoming Relation(s) |
| UDP-α-D-kanosamine (CHEBI:32275) is conjugate acid of UDP-α-D-kanosamine(1−) (CHEBI:71964) |
| IUPAC Name |
|---|
| uridine 5'-[3-(3-azaniumyl-3-deoxy-α-D-glucopyranosyl) diphosphate] |
| UniProt Name | Source |
|---|---|
| UDP-α-D-kanosamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-10223 | MetaCyc |