EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H29N5O6S |
| Net Charge | 0 |
| Average Mass | 599.669 |
| Monoisotopic Mass | 599.18385 |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(NC(=O)c3ccc(C)c(OC)c3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C31H29N5O6S/c1-19-9-10-20(15-28(19)42-4)31(37)33-21-11-13-25(14-12-21)43(38,39)36-30-29(34-26-7-5-6-8-27(26)35-30)32-22-16-23(40-2)18-24(17-22)41-3/h5-18H,1-4H3,(H,32,34)(H,33,37)(H,35,36) |
| InChIKey | HJSSPYJVWLTYHG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XL765 (CHEBI:71958) has role antineoplastic agent (CHEBI:35610) |
| XL765 (CHEBI:71958) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| XL765 (CHEBI:71958) has role mTOR inhibitor (CHEBI:68481) |
| XL765 (CHEBI:71958) is a aromatic amine (CHEBI:33860) |
| XL765 (CHEBI:71958) is a aromatic ether (CHEBI:35618) |
| XL765 (CHEBI:71958) is a benzamides (CHEBI:22702) |
| XL765 (CHEBI:71958) is a quinoxaline derivative (CHEBI:38771) |
| XL765 (CHEBI:71958) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-[4-({3-[(3,5-dimethoxyphenyl)amino]quinoxalin-2-yl}sulfamoyl)phenyl]-3-methoxy-4-methylbenzamide |
| Synonyms | Source |
|---|---|
| XL 765 | ChEBI |
| XL-765 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1174 | LINCS |
| Citations |
|---|