EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16N6O2S2 |
| Net Charge | 0 |
| Average Mass | 448.533 |
| Monoisotopic Mass | 448.07762 |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc3ccccc3nc2Nc2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C21H16N6O2S2/c1-13-6-9-15(10-7-13)31(28,29)27-21-20(23-16-4-2-3-5-17(16)24-21)22-14-8-11-18-19(12-14)26-30-25-18/h2-12H,1H3,(H,22,23)(H,24,27) |
| InChIKey | MQMKRQLTIWPEDM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XL147 (CHEBI:71957) has role antineoplastic agent (CHEBI:35610) |
| XL147 (CHEBI:71957) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| XL147 (CHEBI:71957) is a aromatic amine (CHEBI:33860) |
| XL147 (CHEBI:71957) is a benzothiadiazole (CHEBI:48864) |
| XL147 (CHEBI:71957) is a quinoxaline derivative (CHEBI:38771) |
| XL147 (CHEBI:71957) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-[3-(2,1,3-benzothiadiazol-5-ylamino)quinoxalin-2-yl]-4-methylbenzenesulfonamide |
| Synonyms | Source |
|---|---|
| XL 147 | ChemIDplus |
| XL-147 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-5998 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1033110-57-4 | ChemIDplus |
| Citations |
|---|