EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21F3N6O2 |
| Net Charge | 0 |
| Average Mass | 410.400 |
| Monoisotopic Mass | 410.16781 |
| SMILES | Nc1cc(C(F)(F)F)c(-c2cc(N3CCOCC3)nc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C18H21F3N6O2/c19-18(20,21)13-9-15(22)23-11-12(13)14-10-16(26-1-5-28-6-2-26)25-17(24-14)27-3-7-29-8-4-27/h9-11H,1-8H2,(H2,22,23) |
| InChIKey | CWHUFRVAEUJCEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BKM120 (CHEBI:71954) has role antifibrotic agent (CHEBI:233423) |
| BKM120 (CHEBI:71954) has role antineoplastic agent (CHEBI:35610) |
| BKM120 (CHEBI:71954) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| BKM120 (CHEBI:71954) has role renoprotective agent (CHEBI:231911) |
| BKM120 (CHEBI:71954) is a aminopyridine (CHEBI:38207) |
| BKM120 (CHEBI:71954) is a aminopyrimidine (CHEBI:38338) |
| BKM120 (CHEBI:71954) is a morpholines (CHEBI:38785) |
| BKM120 (CHEBI:71954) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 5-[2,6-di(morpholin-4-yl)pyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine |
| INN | Source |
|---|---|
| buparlisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BKM 120 | ChemIDplus |
| BKM-120 | ChEMBL |
| BKM-120NX | ChEMBL |
| BKM120-NX | ChEMBL |
| buparlisib | ChEMBL |
| NVP-BKM-120 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-1148 | LINCS |
| WO2007084786 | Patent |
| WO2012044727 | Patent |
| WO2012109423 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12938097 | Reaxys |
| CAS:1202777-78-3 | ChemIDplus |
| Citations |
|---|