EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21F3N6O2 |
| Net Charge | 0 |
| Average Mass | 410.400 |
| Monoisotopic Mass | 410.16781 |
| SMILES | Nc1cc(C(F)(F)F)c(-c2cc(N3CCOCC3)nc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C18H21F3N6O2/c19-18(20,21)13-9-15(22)23-11-12(13)14-10-16(26-1-5-28-6-2-26)25-17(24-14)27-3-7-29-8-4-27/h9-11H,1-8H2,(H2,22,23) |
| InChIKey | CWHUFRVAEUJCEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BKM120 (CHEBI:71954) has role antineoplastic agent (CHEBI:35610) |
| BKM120 (CHEBI:71954) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| BKM120 (CHEBI:71954) is a aminopyridine (CHEBI:38207) |
| BKM120 (CHEBI:71954) is a aminopyrimidine (CHEBI:38338) |
| BKM120 (CHEBI:71954) is a morpholines (CHEBI:38785) |
| BKM120 (CHEBI:71954) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 5-[2,6-di(morpholin-4-yl)pyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine |
| Synonyms | Source |
|---|---|
| BKM 120 | ChemIDplus |
| NVP-BKM120 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LSM-1148 | LINCS |
| WO2007084786 | Patent |
| WO2012044727 | Patent |
| WO2012109423 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12938097 | Reaxys |
| CAS:1202777-78-3 | ChemIDplus |
| Citations |
|---|