EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H23N5O |
| Net Charge | 0 |
| Average Mass | 469.548 |
| Monoisotopic Mass | 469.19026 |
| SMILES | Cn1c(=O)n(-c2ccc(C(C)(C)C#N)cc2)c2c3cc(-c4cnc5ccccc5c4)ccc3ncc21 |
| InChI | InChI=1S/C30H23N5O/c1-30(2,18-31)22-9-11-23(12-10-22)35-28-24-15-19(21-14-20-6-4-5-7-25(20)32-16-21)8-13-26(24)33-17-27(28)34(3)29(35)36/h4-17H,1-3H3 |
| InChIKey | JOGKUKXHTYWRGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dactolisib (CHEBI:71952) has role antineoplastic agent (CHEBI:35610) |
| dactolisib (CHEBI:71952) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| dactolisib (CHEBI:71952) has role mTOR inhibitor (CHEBI:68481) |
| dactolisib (CHEBI:71952) is a imidazoquinoline (CHEBI:38776) |
| dactolisib (CHEBI:71952) is a nitrile (CHEBI:18379) |
| dactolisib (CHEBI:71952) is a quinolines (CHEBI:26513) |
| dactolisib (CHEBI:71952) is a ring assembly (CHEBI:36820) |
| dactolisib (CHEBI:71952) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 2-methyl-2-{4-[3-methyl-2-oxo-8-(quinolin-3-yl)-2,3-dihydro-1H-imidazo[4,5-c]quinolin-1-yl]phenyl}propanenitrile |
| Synonyms | Source |
|---|---|
| BEZ 235 | ChemIDplus |
| BEZ-235 | ChemIDplus |
| BEZ235 | SUBMITTER |
| NVP BEZ235 | ChemIDplus |
| NVP-BEZ 235 | ChemIDplus |
| NVP-BEZ235 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LSM-4255 | LINCS |
| WO2006122806 | Patent |
| WO2008064093 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12748665 | Reaxys |
| CAS:915019-65-7 | ChemIDplus |
| Citations |
|---|