EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H23N5O |
| Net Charge | 0 |
| Average Mass | 469.548 |
| Monoisotopic Mass | 469.19026 |
| SMILES | Cn1c(=O)n(-c2ccc(C(C)(C)C#N)cc2)c2c3cc(-c4cnc5ccccc5c4)ccc3ncc21 |
| InChI | InChI=1S/C30H23N5O/c1-30(2,18-31)22-9-11-23(12-10-22)35-28-24-15-19(21-14-20-6-4-5-7-25(20)32-16-21)8-13-26(24)33-17-27(28)34(3)29(35)36/h4-17H,1-3H3 |
| InChIKey | JOGKUKXHTYWRGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. mTOR inhibitor A protein kinase inhibitor of the mammalian target of rapamycin (mTOR), a protein that regulates cell growth, cell proliferation, cell motility, cell survival, protein synthesis and transcription. mTOR inhibitors are used to prevent transplant rejection and in treatment of cancer. EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dactolisib (CHEBI:71952) has role antiinfective agent (CHEBI:35441) |
| dactolisib (CHEBI:71952) has role antineoplastic agent (CHEBI:35610) |
| dactolisib (CHEBI:71952) has role antiviral agent (CHEBI:22587) |
| dactolisib (CHEBI:71952) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| dactolisib (CHEBI:71952) has role mTOR inhibitor (CHEBI:68481) |
| dactolisib (CHEBI:71952) is a imidazoquinoline (CHEBI:38776) |
| dactolisib (CHEBI:71952) is a nitrile (CHEBI:18379) |
| dactolisib (CHEBI:71952) is a quinolines (CHEBI:26513) |
| dactolisib (CHEBI:71952) is a ring assembly (CHEBI:36820) |
| dactolisib (CHEBI:71952) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 2-methyl-2-{4-[3-methyl-2-oxo-8-(quinolin-3-yl)-2,3-dihydro-1H-imidazo[4,5-c]quinolin-1-yl]phenyl}propanenitrile |
| INN | Source |
|---|---|
| dactolisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BEZ 235 | ChemIDplus |
| BEZ-235 | ChemIDplus |
| BEZ235 | SUBMITTER |
| NSC-751249 | ChEMBL |
| Nvp-bez-235 | ChEMBL |
| NVP BEZ235 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-4255 | LINCS |
| WO2006122806 | Patent |
| WO2008064093 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12748665 | Reaxys |
| CAS:915019-65-7 | ChemIDplus |
| Citations |
|---|