EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C72H90N16O12 |
| Net Charge | 0 |
| Average Mass | 1371.612 |
| Monoisotopic Mass | 1370.69241 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN)NC(=O)[C@H](C(C)C)NC(=O)[C@]([H])(Cc1cnc3ccccc13)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](Cc1cnc3ccccc13)NC(=O)[C@H](Cc1cnc3ccccc13)NC2=O |
| InChI | InChI=1S/C72H90N16O12/c1-39(2)30-53-65(93)86-58(31-41-16-6-5-7-17-41)72(100)88-29-15-25-59(88)70(98)85-55(33-43-37-77-49-22-12-9-19-46(43)49)67(95)83-54(32-42-36-76-48-21-11-8-18-45(42)48)66(94)84-57(35-61(75)90)68(96)79-52(26-27-60(74)89)64(92)82-56(34-44-38-78-50-23-13-10-20-47(44)50)69(97)87-62(40(3)4)71(99)80-51(24-14-28-73)63(91)81-53/h5-13,16-23,36-40,51-59,62,76-78H,14-15,24-35,73H2,1-4H3,(H2,74,89)(H2,75,90)(H,79,96)(H,80,99)(H,81,91)(H,82,92)(H,83,95)(H,84,94)(H,85,98)(H,86,93)(H,87,97)/t51-,52-,53-,54+,55-,56-,57-,58+,59-,62-/m0/s1 |
| InChIKey | MSPVTUIBMQIOJP-ZFQMPNKVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrocidine D (CHEBI:71950) has role antibacterial agent (CHEBI:33282) |
| tyrocidine D (CHEBI:71950) has role metabolite (CHEBI:25212) |
| tyrocidine D (CHEBI:71950) is a homodetic cyclic peptide (CHEBI:24613) |
| tyrocidine D (CHEBI:71950) is a macrocycle (CHEBI:51026) |
| tyrocidine D (CHEBI:71950) is a peptide antibiotic (CHEBI:25903) |
| Incoming Relation(s) |
| tyrocidine (CHEBI:71947) has part tyrocidine D (CHEBI:71950) |
| IUPAC Name |
|---|
| cyclo(L-asparaginyl-L-glutaminyl-L-tryptophyl-L-valyl-L-ornithyl-L-leucyl-D-phenylalanyl-L-prolyl-L-tryptophyl-D-tryptophyl) |
| Synonym | Source |
|---|---|
| cyclo-(D-Phe-Pro-Trp-D-Trp-Asn-Gln-Trp-Val-Orn-Leu) | ChEBI |