EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C70H89N15O13 |
| Net Charge | 0 |
| Average Mass | 1348.574 |
| Monoisotopic Mass | 1347.67643 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN)NC(=O)[C@H](C(C)C)NC(=O)[C@]([H])(Cc1ccc(O)cc1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](Cc1cnc3ccccc13)NC(=O)[C@H](Cc1cnc3ccccc13)NC2=O |
| InChI | InChI=1S/C70H89N15O13/c1-38(2)30-51-63(91)83-56(32-40-14-6-5-7-15-40)70(98)85-29-13-21-57(85)68(96)82-54(34-43-37-75-48-19-11-9-17-46(43)48)65(93)80-53(33-42-36-74-47-18-10-8-16-45(42)47)64(92)81-55(35-59(73)88)66(94)76-50(26-27-58(72)87)62(90)79-52(31-41-22-24-44(86)25-23-41)67(95)84-60(39(3)4)69(97)77-49(20-12-28-71)61(89)78-51/h5-11,14-19,22-25,36-39,49-57,60,74-75,86H,12-13,20-21,26-35,71H2,1-4H3,(H2,72,87)(H2,73,88)(H,76,94)(H,77,97)(H,78,89)(H,79,90)(H,80,93)(H,81,92)(H,82,96)(H,83,91)(H,84,95)/t49-,50-,51-,52-,53+,54-,55-,56+,57-,60-/m0/s1 |
| InChIKey | NJMWWUADORPGGY-AJOXBXEMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brevibacillus brevis (ncbitaxon:1393) | - | PubMed (4320358) | Strain: ATCC 8185 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrocidine C (CHEBI:71949) has role antibacterial agent (CHEBI:33282) |
| tyrocidine C (CHEBI:71949) has role bacterial metabolite (CHEBI:76969) |
| tyrocidine C (CHEBI:71949) has role metabolite (CHEBI:25212) |
| tyrocidine C (CHEBI:71949) is a homodetic cyclic peptide (CHEBI:24613) |
| tyrocidine C (CHEBI:71949) is a macrocycle (CHEBI:51026) |
| tyrocidine C (CHEBI:71949) is a peptide antibiotic (CHEBI:25903) |
| Incoming Relation(s) |
| tyrocidine (CHEBI:71947) has part tyrocidine C (CHEBI:71949) |
| IUPAC Name |
|---|
| cyclo(L-asparaginyl-L-glutaminyl-L-tyrosyl-L-valyl-L-ornithyl-L-leucyl-D-phenylalanyl-L-prolyl-L-tryptophyl-D-tryptophyl) |
| Synonym | Source |
|---|---|
| cyclo-(D-Phe-Pro-Trp-D-Trp-Asn-Gln-Tyr-Val-Orn-Leu) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:506204 | Reaxys |