EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C70H89N15O13 |
| Net Charge | 0 |
| Average Mass | 1348.574 |
| Monoisotopic Mass | 1347.67643 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN)NC(=O)[C@H](C(C)C)NC(=O)[C@]([H])(Cc1ccc(O)cc1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](Cc1cnc3ccccc13)NC(=O)[C@H](Cc1cnc3ccccc13)NC2=O |
| InChI | InChI=1S/C70H89N15O13/c1-38(2)30-51-63(91)83-56(32-40-14-6-5-7-15-40)70(98)85-29-13-21-57(85)68(96)82-54(34-43-37-75-48-19-11-9-17-46(43)48)65(93)80-53(33-42-36-74-47-18-10-8-16-45(42)47)64(92)81-55(35-59(73)88)66(94)76-50(26-27-58(72)87)62(90)79-52(31-41-22-24-44(86)25-23-41)67(95)84-60(39(3)4)69(97)77-49(20-12-28-71)61(89)78-51/h5-11,14-19,22-25,36-39,49-57,60,74-75,86H,12-13,20-21,26-35,71H2,1-4H3,(H2,72,87)(H2,73,88)(H,76,94)(H,77,97)(H,78,89)(H,79,90)(H,80,93)(H,81,92)(H,82,96)(H,83,91)(H,84,95)/t49-,50-,51-,52-,53+,54-,55-,56+,57-,60-/m0/s1 |
| InChIKey | NJMWWUADORPGGY-AJOXBXEMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brevibacillus brevis (ncbitaxon:1393) | - | PubMed (4320358) | Strain: ATCC 8185 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrocidine C (CHEBI:71949) has role antibacterial agent (CHEBI:33282) |
| tyrocidine C (CHEBI:71949) has role bacterial metabolite (CHEBI:76969) |
| tyrocidine C (CHEBI:71949) has role metabolite (CHEBI:25212) |
| tyrocidine C (CHEBI:71949) is a homodetic cyclic peptide (CHEBI:24613) |
| tyrocidine C (CHEBI:71949) is a macrocycle (CHEBI:51026) |
| tyrocidine C (CHEBI:71949) is a peptide antibiotic (CHEBI:25903) |
| Incoming Relation(s) |
| tyrocidine (CHEBI:71947) has part tyrocidine C (CHEBI:71949) |
| IUPAC Name |
|---|
| cyclo(L-asparaginyl-L-glutaminyl-L-tyrosyl-L-valyl-L-ornithyl-L-leucyl-D-phenylalanyl-L-prolyl-L-tryptophyl-D-tryptophyl) |
| Synonym | Source |
|---|---|
| cyclo-(D-Phe-Pro-Trp-D-Trp-Asn-Gln-Tyr-Val-Orn-Leu) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:506204 | Reaxys |