EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C68H88N14O13 |
| Net Charge | 0 |
| Average Mass | 1309.537 |
| Monoisotopic Mass | 1308.66553 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN)NC(=O)[C@H](C(C)C)NC(=O)[C@]([H])(Cc1ccc(O)cc1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](Cc1cnc3ccccc13)NC2=O |
| InChI | InChI=1S/C68H88N14O13/c1-38(2)31-49-61(88)80-54(34-41-17-9-6-10-18-41)68(95)82-30-14-22-55(82)66(93)79-52(35-43-37-72-46-20-12-11-19-45(43)46)63(90)77-50(32-40-15-7-5-8-16-40)62(89)78-53(36-57(71)85)64(91)73-48(27-28-56(70)84)60(87)76-51(33-42-23-25-44(83)26-24-42)65(92)81-58(39(3)4)67(94)74-47(21-13-29-69)59(86)75-49/h5-12,15-20,23-26,37-39,47-55,58,72,83H,13-14,21-22,27-36,69H2,1-4H3,(H2,70,84)(H2,71,85)(H,73,91)(H,74,94)(H,75,86)(H,76,87)(H,77,90)(H,78,89)(H,79,93)(H,80,88)(H,81,92)/t47-,48-,49-,50+,51-,52-,53-,54+,55-,58-/m0/s1 |
| InChIKey | PUVWPDQSNYAMEH-UQHIYWQBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brevibacillus brevis (ncbitaxon:1393) | - | PubMed (4320358) | Strain: ATCC 8185 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyrocidine B (CHEBI:71948) has role antibacterial agent (CHEBI:33282) |
| tyrocidine B (CHEBI:71948) has role bacterial metabolite (CHEBI:76969) |
| tyrocidine B (CHEBI:71948) is a homodetic cyclic peptide (CHEBI:24613) |
| tyrocidine B (CHEBI:71948) is a macrocycle (CHEBI:51026) |
| tyrocidine B (CHEBI:71948) is a peptide antibiotic (CHEBI:25903) |
| Incoming Relation(s) |
| tyrocidine (CHEBI:71947) has part tyrocidine B (CHEBI:71948) |
| IUPAC Name |
|---|
| cyclo(L-asparaginyl-L-glutaminyl-L-tyrosyl-L-valyl-L-ornithyl-L-leucyl-D-phenylalanyl-L-prolyl-L-tryptophyl-D-phenylalanyl) |
| Synonym | Source |
|---|---|
| cyclo-(D-Phe-Pro-Trp-D-Phe-Asn-Gln-Tyr-Val-Orn-Leu) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:505981 | Reaxys |
| Citations |
|---|