EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H39NO19 |
| Net Charge | 0 |
| Average Mass | 633.553 |
| Monoisotopic Mass | 633.21163 |
| SMILES | [H][C@@]1([C@H](O)[C@H](O)CO)O[C@@](OC[C@H]2O[C@@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](O)O[C@@H]3CO)[C@H](O)[C@@H](O)[C@H]2O)(C(=O)O)C[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C23H39NO19/c1-6(27)24-11-7(28)2-23(22(37)38,43-19(11)12(30)8(29)3-25)39-5-10-13(31)14(32)17(35)21(41-10)42-18-9(4-26)40-20(36)16(34)15(18)33/h7-21,25-26,28-36H,2-5H2,1H3,(H,24,27)(H,37,38)/t7-,8+,9+,10+,11+,12+,13-,14-,15+,16+,17+,18+,19+,20+,21-,23+/m0/s1 |
| InChIKey | TYALNJQZQRNQNQ-JLYOMPFMSA-N |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-Neup5Ac-(2→6)-β-D-Galp-(1→4)-β-D-Glcp (CHEBI:71943) has role epitope (CHEBI:53000) |
| α-Neup5Ac-(2→6)-β-D-Galp-(1→4)-β-D-Glcp (CHEBI:71943) is a amino trisaccharide (CHEBI:59266) |
| IUPAC Name |
|---|
| 5-acetamido-3,5-dideoxy-D-glycero-α-D-galacto-non-2-ulopyranonosyl-(2→6)-β-D-galactopyranosyl-(1→4)-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| α-D-N-acetylneuraminyl-(2→6)-β-D-galactosyl-(1→4)-β-D-glucose | ChEBI |
| α-Neu5Ac-(2→6)-β-D-Gal-(1→4)-β-D-Glc | ChEBI |
| Neu5Acα2-6Galβ1-4Glcβ | ChEBI |
| Neu5NAcα2→6lactose | ChEBI |
| 6'-sialyllactose | ChEBI |
| 6'-SL | ChEBI |
| Citations |
|---|