EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO3 |
| Net Charge | 0 |
| Average Mass | 257.289 |
| Monoisotopic Mass | 257.10519 |
| SMILES | Cc1ccc(C(=O)c2ccc(CC(=O)O)n2C)cc1 |
| InChI | InChI=1S/C15H15NO3/c1-10-3-5-11(6-4-10)15(19)13-8-7-12(16(13)2)9-14(17)18/h3-8H,9H2,1-2H3,(H,17,18) |
| InChIKey | UPSPUYADGBWSHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolmetin (CHEBI:71941) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| tolmetin (CHEBI:71941) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| tolmetin (CHEBI:71941) is a aromatic ketone (CHEBI:76224) |
| tolmetin (CHEBI:71941) is a monocarboxylic acid (CHEBI:25384) |
| tolmetin (CHEBI:71941) is a pyrroles (CHEBI:26455) |
| tolmetin (CHEBI:71941) is conjugate acid of tolmetin(1−) (CHEBI:72213) |
| Incoming Relation(s) |
| tolmetin(1−) (CHEBI:72213) is conjugate base of tolmetin (CHEBI:71941) |
| IUPAC Name |
|---|
| [1-methyl-5-(4-methylbenzoyl)-1H-pyrrol-2-yl]acetic acid |
| INNs | Source |
|---|---|
| tolmetin | KEGG DRUG |
| tolmetino | DrugBank |
| tolmetinum | DrugBank |
| tolmetine | DrugBank |
| Synonyms | Source |
|---|---|
| tolmetina | DrugBank |
| 1-Methyl-5-p-toluoylpyrrole-2-acetic acid | ChemIDplus |
| 5-(p-Toluoyl)-1-methylpyrrole-2-acetic acid | ChemIDplus |
| 1-Methyl-5-(4-methylbenzoyl)-pyrrole-2-acetic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07149 | KEGG COMPOUND |
| TLT | PDBeChem |
| D02355 | KEGG DRUG |
| DB00500 | DrugBank |
| WO2009072139 | Patent |
| WO2004069782 | Patent |
| DE2836902 | Patent |
| WO2008017903 | Patent |
| HMDB0014643 | HMDB |
| Tolmetin | Wikipedia |
| MX2010012712 | Patent |
| LSM-3852 | LINCS |
| 2699 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:485305 | Reaxys |
| CAS:26171-23-3 | KEGG COMPOUND |
| CAS:26171-23-3 | ChemIDplus |
| CAS:26171-23-3 | NIST Chemistry WebBook |
| Citations |
|---|