EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N5O5 |
| Net Charge | 0 |
| Average Mass | 351.363 |
| Monoisotopic Mass | 351.15427 |
| SMILES | C/C(=C\CNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)CO |
| InChI | InChI=1S/C15H21N5O5/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(24)11(23)9(5-22)25-15/h2,6-7,9,11-12,15,21-24H,3-5H2,1H3,(H,16,17,18)/b8-2+/t9-,11-,12-,15-/m1/s1 |
| InChIKey | GOSWTRUMMSCNCW-HNNGNKQASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cucumis sativus (ncbitaxon:3659) | - | PubMed (12379786) | |
| Psilotum nudum (ncbitaxon:3240) | - | PubMed (20488581) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-ribosyl-trans-zeatin (CHEBI:71693) has functional parent adenosine (CHEBI:16335) |
| 9-ribosyl-trans-zeatin (CHEBI:71693) has role cytokinin (CHEBI:23530) |
| 9-ribosyl-trans-zeatin (CHEBI:71693) has role plant metabolite (CHEBI:76924) |
| 9-ribosyl-trans-zeatin (CHEBI:71693) is a 9-ribosylzeatin (CHEBI:20838) |
| 9-ribosyl-trans-zeatin (CHEBI:71693) is a nucleoside analogue (CHEBI:60783) |
| IUPAC Name |
|---|
| N-[(2E)-4-hydroxy-3-methylbut-2-en-1-yl]adenosine |
| Synonyms | Source |
|---|---|
| trans-Zeatin riboside | KEGG COMPOUND |
| (E)-N-(4-Hydroxy-3-methyl-2-butenyl)adenosine | ChemIDplus |
| zeatin riboside | MetaCyc |
| 9-β-D-ribofuranosyl-trans-zeatin | ChEBI |
| trans-zeatin 9-β-D-ribofuranoside | ChEBI |
| 9-β-D-ribosyl-trans-zeatin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16431 | KEGG COMPOUND |
| CPD-4208 | MetaCyc |
| C00000096 | KNApSAcK |
| HMDB0030388 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:630954 | Reaxys |
| CAS:6025-53-2 | ChemIDplus |
| Citations |
|---|