EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]1([C@H](C)CCC=C(C)C)C=CC(C)=CC1 |
| InChI | InChI=1S/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8-10,14-15H,5,7,11H2,1-4H3/t14-,15-/m1/s1 |
| InChIKey | KKOXKGNSUHTUBV-HUUCEWRRSA-N |
| Roles Classification |
|---|
| Biological Role: | semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| Application: | insect repellent An insecticide that acts as a repellent to insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-epi-zingiberene (CHEBI:71688) has role insect repellent (CHEBI:71692) |
| 7-epi-zingiberene (CHEBI:71688) has role semiochemical (CHEBI:26645) |
| 7-epi-zingiberene (CHEBI:71688) is a cycloalkene (CHEBI:33643) |
| 7-epi-zingiberene (CHEBI:71688) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (5R)-2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]cyclohexa-1,3-diene |
| Synonyms | Source |
|---|---|
| (−)-(4S,7R)-7-epi-zingiberene | ChEBI |
| (−)-(4S,7R)-7-epizingiberene | ChEBI |
| UniProt Name | Source |
|---|---|
| 7-epizingiberene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| US2012087889 | Patent |
| WO2009041814 | Patent |
| WO2010099985 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7073837 | Reaxys |
| Citations |
|---|