EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O7P |
| Net Charge | 0 |
| Average Mass | 212.094 |
| Monoisotopic Mass | 212.00859 |
| SMILES | CC(=O)C(=O)[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H9O7P/c1-3(6)5(8)4(7)2-12-13(9,10)11/h4,7H,2H2,1H3,(H2,9,10,11)/t4-/m0/s1 |
| InChIKey | DTZHMTDUIGHESZ-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-hydroxy-3,4-diketopentyl phosphate (CHEBI:71684) is a monoalkyl phosphate (CHEBI:25381) |
| (2S)-2-hydroxy-3,4-diketopentyl phosphate (CHEBI:71684) is a secondary alcohol (CHEBI:35681) |
| (2S)-2-hydroxy-3,4-diketopentyl phosphate (CHEBI:71684) is a secondary α-hydroxy ketone (CHEBI:2468) |
| (2S)-2-hydroxy-3,4-diketopentyl phosphate (CHEBI:71684) is a α-diketone (CHEBI:51869) |
| (2S)-2-hydroxy-3,4-diketopentyl phosphate (CHEBI:71684) is conjugate acid of (2S)-2-hydroxy-3,4-diketopentyl phosphate(2−) (CHEBI:71677) |
| Incoming Relation(s) |
| (2S)-2-hydroxy-3,4-diketopentyl phosphate(2−) (CHEBI:71677) is conjugate base of (2S)-2-hydroxy-3,4-diketopentyl phosphate (CHEBI:71684) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-3,4-dioxopentyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| (2S)-2-hydroxy-3,4-dioxopentyl phosphate | ChEBI |
| (S)-4-hydroxy-5-phosphonooxypentane-2,3-dione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 28533713 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22344264 | Reaxys |