EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O7 |
| Net Charge | 0 |
| Average Mass | 276.245 |
| Monoisotopic Mass | 276.09575 |
| SMILES | N[C@H](CCC(=O)N[C@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O7/c11-5(9(16)17)1-3-7(13)12-6(10(18)19)2-4-8(14)15/h5-6H,1-4,11H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19)/t5-,6-/m1/s1 |
| InChIKey | OWQDWQKWSLFFFR-PHDIDXHHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-γ-glutamyl-D-glutamic acid (CHEBI:71683) is a dipeptide (CHEBI:46761) |
| D-γ-glutamyl-D-glutamic acid (CHEBI:71683) is conjugate acid of D-γ-glutamyl-D-glutamate(2−) (CHEBI:71681) |
| Incoming Relation(s) |
| D-γ-glutamyl-D-glutamate(2−) (CHEBI:71681) is conjugate base of D-γ-glutamyl-D-glutamic acid (CHEBI:71683) |
| IUPAC Name |
|---|
| D-γ-glutamyl-D-glutamic acid |
| Synonym | Source |
|---|---|
| D-γ-Glu-D-Glu | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729789 | Reaxys |