EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45NO4 |
| Net Charge | 0 |
| Average Mass | 447.660 |
| Monoisotopic Mass | 447.33486 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])C[C@]3([H])O[C@@]5(NC[C@@H](CO)C[C@@H]5O)[C@@H](C)[C@]43[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C27H45NO4/c1-15-24-22(32-27(15)23(31)10-16(14-29)13-28-27)12-21-19-5-4-17-11-18(30)6-8-25(17,2)20(19)7-9-26(21,24)3/h15-24,28-31H,4-14H2,1-3H3/t15-,16-,17-,18-,19+,20-,21-,22-,23-,24-,25-,26-,27-/m0/s1 |
| InChIKey | FBKQAVWTYDQPAB-HBDLFPIVSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 2.3.1.26 (sterol O-acyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of acyl-CoA:cholesterol acyltransferase (EC 2.3.1.26). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| esculeogenin A (CHEBI:71676) has role EC 2.3.1.26 (sterol O-acyltransferase) inhibitor (CHEBI:64696) |
| esculeogenin A (CHEBI:71676) has role metabolite (CHEBI:25212) |
| esculeogenin A (CHEBI:71676) is a 3β-hydroxy steroid (CHEBI:36836) |
| esculeogenin A (CHEBI:71676) is a azaspiro compound (CHEBI:35624) |
| esculeogenin A (CHEBI:71676) is a oxaspiro compound (CHEBI:37948) |
| esculeogenin A (CHEBI:71676) is a sapogenin (CHEBI:26606) |
| IUPAC Name |
|---|
| (3β,5α,22α,23S,25S)-spirosolane-3,23,27-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9826338 | Reaxys |
| Citations |
|---|