EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O3 |
| Net Charge | 0 |
| Average Mass | 246.266 |
| Monoisotopic Mass | 246.10044 |
| SMILES | C[C@H](NC(=O)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C13H14N2O3/c1-8(13(17)18)15-12(16)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7-8,14H,6H2,1H3,(H,15,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | FBDCJLXTUCMFLF-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(indole-3-acetyl)-L-alanine (CHEBI:71672) is a N-acyl-L-alanine (CHEBI:83946) |
| N-(indole-3-acetyl)-L-alanine (CHEBI:71672) is a indoleacetic acid amide conjugate (CHEBI:64632) |
| IUPAC Name |
|---|
| N-(1H-indol-3-ylacetyl)-L-alanine |
| Synonyms | Source |
|---|---|
| N-(indole-3-acetyl)alanine | ChEBI |
| IAA-L-Ala | ChEBI |
| IAA-Ala | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4260214 | Reaxys |