EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | O=C1c2cc(O)cc(O)c2C(=O)c2c1cc(O)c([C@@H](CO)CCO)c2O |
| InChI | InChI=1S/C18H16O8/c19-2-1-7(6-20)13-12(23)5-10-15(17(13)25)18(26)14-9(16(10)24)3-8(21)4-11(14)22/h3-5,7,19-23,25H,1-2,6H2/t7-/m1/s1 |
| InChIKey | ZLIRCPWCWHTYNP-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-versiconol (CHEBI:71665) is a versiconol (CHEBI:71639) |
| (S)-versiconol (CHEBI:71665) is conjugate acid of (S)-versiconol(1−) (CHEBI:77947) |
| Incoming Relation(s) |
| (S)-versiconol(1−) (CHEBI:77947) is conjugate base of (S)-versiconol (CHEBI:71665) |
| IUPAC Name |
|---|
| 2-[(2S)-1,4-dihydroxybutan-2-yl]-1,3,6,8-tetrahydroxy-9,10-anthraquinone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7341993 | Reaxys |
| CAS:22268-13-9 | ChemIDplus |