EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O7 |
| Net Charge | 0 |
| Average Mass | 422.518 |
| Monoisotopic Mass | 422.23045 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@@H](O)CC[C@]3(CO)[C@@]1([H])[C@H](O)C[C@@]1(C)[C@]2(O)CC[C@]1([H])C1=CC(=O)OC1 |
| InChI | InChI=1S/C23H34O7/c1-20-10-17(26)19-16(3-6-22(28)9-14(25)2-5-21(19,22)12-24)23(20,29)7-4-15(20)13-8-18(27)30-11-13/h8,14-17,19,24-26,28-29H,2-7,9-12H2,1H3/t14-,15+,16+,17+,19+,20+,21-,22-,23-/m0/s1 |
| InChIKey | MLPFCOJXAGAUJR-GBLUZQOCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sarmentologenin (CHEBI:71625) has parent hydride 5β-cardanolide (CHEBI:35542) |
| sarmentologenin (CHEBI:71625) has role metabolite (CHEBI:25212) |
| sarmentologenin (CHEBI:71625) is a butenolide (CHEBI:50523) |
| sarmentologenin (CHEBI:71625) is a hydroxy steroid (CHEBI:35350) |
| sarmentologenin (CHEBI:71625) is a steroid lactone (CHEBI:26766) |
| Incoming Relation(s) |
| elaeodendroside V (CHEBI:65830) has functional parent sarmentologenin (CHEBI:71625) |
| IUPAC Name |
|---|
| (3β,5β,11α)-3,5,11,14,19-pentahydroxycard-20(22)-enolide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:56600 | Reaxys |
| CAS:6785-68-8 | ChemIDplus |