EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48N2O6 |
| Net Charge | 0 |
| Average Mass | 580.766 |
| Monoisotopic Mass | 580.35124 |
| SMILES | C/C(=C/C=C/C=C/C(C)C(=O)O)NC(=O)CC(O)/C(C)=C\C=C/C=C(C)/C=C/C=C\C=C\CNC(=O)C(O)CC(C)C |
| InChI | InChI=1S/C34H48N2O6/c1-25(2)23-31(38)33(40)35-22-16-9-7-8-11-17-26(3)18-14-15-19-27(4)30(37)24-32(39)36-29(6)21-13-10-12-20-28(5)34(41)42/h7-21,25,28,30-31,37-38H,22-24H2,1-6H3,(H,35,40)(H,36,39)(H,41,42)/b8-7-,13-10+,15-14-,16-9+,17-11+,20-12+,26-18+,27-19-,29-21- |
| InChIKey | KDQMRYTZELJKOB-MAHROAIDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bacillaene (CHEBI:71623) has role antibacterial agent (CHEBI:33282) |
| bacillaene (CHEBI:71623) has role antimicrobial agent (CHEBI:33281) |
| bacillaene (CHEBI:71623) has role bacterial metabolite (CHEBI:76969) |
| bacillaene (CHEBI:71623) is a enamine (CHEBI:47989) |
| bacillaene (CHEBI:71623) is a monocarboxylic acid amide (CHEBI:29347) |
| bacillaene (CHEBI:71623) is a polyene antibiotic (CHEBI:26177) |
| bacillaene (CHEBI:71623) is a polyketide (CHEBI:26188) |
| bacillaene (CHEBI:71623) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3E,5E,7Z)-8-({(4Z,6Z,8E,10E,12Z,14E)-3-hydroxy-16-[(2-hydroxy-4-methylpentanoyl)amino]-4,9-dimethylhexadeca-4,6,8,10,12,14-hexaenoyl}amino)-2-methylnona-3,5,7-trienoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11289554 | Reaxys |
| Citations |
|---|