EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O3 |
| Net Charge | 0 |
| Average Mass | 416.646 |
| Monoisotopic Mass | 416.32905 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCC[C@H](C)C(=O)O |
| InChI | InChI=1S/C27H44O3/c1-17(6-5-7-18(2)25(29)30)22-10-11-23-21-9-8-19-16-20(28)12-14-26(19,3)24(21)13-15-27(22,23)4/h8,17-18,20-24,28H,5-7,9-16H2,1-4H3,(H,29,30)/t17-,18+,20+,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | WVXOMPRLWLXFAP-DDMWTQRYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25S)-cholestenoic acid (CHEBI:71616) is a 3β-hydroxycholest-5-en-26-oic acid (CHEBI:81014) |
| (25S)-cholestenoic acid (CHEBI:71616) is conjugate acid of (25S)-cholestenoate (CHEBI:71567) |
| Incoming Relation(s) |
| (25S)-3β-hydroxy-5-cholesten-26-oyl-CoA (CHEBI:84576) has functional parent (25S)-cholestenoic acid (CHEBI:71616) |
| (25S)-cholestenoate (CHEBI:71567) is conjugate base of (25S)-cholestenoic acid (CHEBI:71616) |
| IUPAC Name |
|---|
| (25S)-3β-hydroxycholest-5-en-26-oic acid |
| Synonym | Source |
|---|---|
| (3β,25S)-3-hydroxycholest-5-en-26-oic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8177572 | ChemSpider |
| LMST04030219 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10043380 | Reaxys |
| Citations |
|---|