EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O3 |
| Net Charge | 0 |
| Average Mass | 414.630 |
| Monoisotopic Mass | 414.31340 |
| SMILES | [H][C@@]12CC=C3[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC[C@@H](C)C(=O)O)[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C27H42O3/c1-17(6-5-7-18(2)25(29)30)22-10-11-23-21-9-8-19-16-20(28)12-14-26(19,3)24(21)13-15-27(22,23)4/h9,17-19,22-24H,5-8,10-16H2,1-4H3,(H,29,30)/t17-,18-,19+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | SQTAVUCHOVVOFD-QAIVWSEESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25R)-Δ7-dafachronic acid (CHEBI:71614) is a 3-oxo Δ7-steroid (CHEBI:71598) |
| (25R)-Δ7-dafachronic acid (CHEBI:71614) is a cholestanoid (CHEBI:50401) |
| (25R)-Δ7-dafachronic acid (CHEBI:71614) is a monocarboxylic acid (CHEBI:25384) |
| (25R)-Δ7-dafachronic acid (CHEBI:71614) is a steroid acid (CHEBI:47891) |
| (25R)-Δ7-dafachronic acid (CHEBI:71614) is conjugate acid of (25R)-Δ7-dafachronate (CHEBI:71569) |
| Incoming Relation(s) |
| (25R)-Δ7-dafachronate (CHEBI:71569) is conjugate base of (25R)-Δ7-dafachronic acid (CHEBI:71614) |
| IUPAC Name |
|---|
| (5α,25R)-3-oxocholest-7-en-26-oic acid |
| Synonym | Source |
|---|---|
| (25R)-3-ketocholest-7-en-26-oic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18860643 | Reaxys |
| Citations |
|---|