EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N2O2 |
| Net Charge | 0 |
| Average Mass | 256.305 |
| Monoisotopic Mass | 256.12118 |
| SMILES | CC(C)/C=c1\nc(=O)/c(=C/c2ccccc2)nc1=O |
| InChI | InChI=1S/C15H16N2O2/c1-10(2)8-12-14(18)17-13(15(19)16-12)9-11-6-4-3-5-7-11/h3-10H,1-2H3,(H,16,19)(H,17,18)/b12-8-,13-9- |
| InChIKey | LCIIOYPBHIZBOD-JMVBYTIWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| albonoursin (CHEBI:71609) has role metabolite (CHEBI:25212) |
| albonoursin (CHEBI:71609) is a 2,5-diketopiperazines (CHEBI:65061) |
| IUPAC Name |
|---|
| (3Z,6Z)-3-benzylidene-6-(2-methylpropylidene)piperazine-2,5-dione |
| Synonyms | Source |
|---|---|
| 3-Benzylidene-6-isobutylidene-2,5-dioxopiperazine | ChemIDplus |
| cyclo(dehydroleucyl-dehydrophenylalanyl) | ChEBI |
| cyclo(dehydrophenylalanyl-dehydroleucyl) | ChEBI |
| cyclo(ΔLeu-ΔPhe) | ChEBI |
| cyclo(ΔPhe-ΔLeu) | ChEBI |
| UniProt Name | Source |
|---|---|
| albonoursin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CN101632367 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:885385 | Reaxys |
| CAS:1222-90-8 | ChemIDplus |
| Citations |
|---|