EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N2O2 |
| Net Charge | 0 |
| Average Mass | 260.337 |
| Monoisotopic Mass | 260.15248 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C15H20N2O2/c1-10(2)8-12-14(18)17-13(15(19)16-12)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3,(H,16,19)(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | QPDMOMIYLJMOQJ-STQMWFEESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclo(L-phenylalanyl-L-leucyl) (CHEBI:71608) has role metabolite (CHEBI:25212) |
| cyclo(L-phenylalanyl-L-leucyl) (CHEBI:71608) is a 2,5-diketopiperazines (CHEBI:65061) |
| IUPAC Name |
|---|
| (3S,6S)-3-benzyl-6-isobutylpiperazine-2,5-dione |
| Synonyms | Source |
|---|---|
| (3S,6S)-3-(2-Methylpropyl)-6-(phenylmethyl)-2,5-piperazinedione | ChemIDplus |
| cFL | SUBMITTER |
| Cyclo(Leu-Phe) | ChemIDplus |
| Cyclo(L-leucyl-L-phenylalanyl) | ChemIDplus |
| Cyclo(Phe-Leu) | ChemIDplus |
| cyclo(L-Leu-L-Phe) | ChEBI |
| UniProt Name | Source |
|---|---|
| cyclo(L-phenylalanyl-L-leucyl) | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:753749 | Reaxys |
| CAS:7280-77-5 | ChemIDplus |
| Citations |
|---|