EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O5 |
| Net Charge | 0 |
| Average Mass | 198.174 |
| Monoisotopic Mass | 198.05282 |
| SMILES | O=C(O)[C@H](O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H10O5/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8,10-12H,4H2,(H,13,14)/t8-/m1/s1 |
| InChIKey | PAFLSMZLRSPALU-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-3-(3,4-dihydroxyphenyl)lactic acid (CHEBI:71572) is a (2R)-2-hydroxy monocarboxylic acid (CHEBI:17893) |
| (2R)-3-(3,4-dihydroxyphenyl)lactic acid (CHEBI:71572) is a 3-(3,4-dihydroxyphenyl)lactic acid (CHEBI:17807) |
| (2R)-3-(3,4-dihydroxyphenyl)lactic acid (CHEBI:71572) is conjugate acid of (2R)-3-(3,4-dihydroxyphenyl)lactate (CHEBI:71492) |
| Incoming Relation(s) |
| (2R)-3-(3,4-dihydroxyphenyl)lactate (CHEBI:71492) is conjugate base of (2R)-3-(3,4-dihydroxyphenyl)lactic acid (CHEBI:71572) |
| IUPAC Name |
|---|
| (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| US2006083798 | Patent |
| CPD-6982 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4746903 | Reaxys |
| Citations |
|---|