EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H58N4O14 |
| Net Charge | 0 |
| Average Mass | 866.962 |
| Monoisotopic Mass | 866.39495 |
| SMILES | [H][C@]12N=C(C(C)C3=N[C@@](C)(CC4=C(CCC(=O)O)[C@](C)(CC(=O)O)C(=N4)/C=C4\N[C@]1(C)[C@@](C)(CC(=O)O)[C@@H]4CCC(=O)O)C(C)=C3CCC(=O)O)[C@](C)(CCC(=O)O)[C@H]2CC(=O)O |
| InChI | InChI=1S/C44H58N4O14/c1-21-37-23(8-11-30(49)50)22(2)43(6,48-37)18-28-24(9-12-31(51)52)41(4,19-35(59)60)29(45-28)17-27-25(10-13-32(53)54)42(5,20-36(61)62)44(7,47-27)39-26(16-34(57)58)40(3,38(21)46-39)15-14-33(55)56/h17,21,25-26,39,47H,8-16,18-20H2,1-7H3,(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)(H,61,62)/b27-17-/t21?,25-,26+,39-,40-,41+,42+,43+,44+/m1/s1 |
| InChIKey | NNXVOJHDIACVHI-DLNMIVMTSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| precorrin-7 (CHEBI:71566) is a precorrin (CHEBI:26228) |
| precorrin-7 (CHEBI:71566) is conjugate acid of precorrin-7(6−) (CHEBI:71490) |
| Incoming Relation(s) |
| precorrin-7(6−) (CHEBI:71490) is conjugate base of precorrin-7 (CHEBI:71566) |
| Citations |
|---|