EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O3 |
| Net Charge | 0 |
| Average Mass | 414.630 |
| Monoisotopic Mass | 414.31340 |
| SMILES | [H][C@@]12CC=C3[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC[C@H](C)C(=O)O)[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C27H42O3/c1-17(6-5-7-18(2)25(29)30)22-10-11-23-21-9-8-19-16-20(28)12-14-26(19,3)24(21)13-15-27(22,23)4/h9,17-19,22-24H,5-8,10-16H2,1-4H3,(H,29,30)/t17-,18+,19+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | SQTAVUCHOVVOFD-OBRBSRNPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (16529801) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25S)-Δ7-dafachronic acid (CHEBI:71556) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| (25S)-Δ7-dafachronic acid (CHEBI:71556) is a Δ7-dafachronic acid (CHEBI:78699) |
| (25S)-Δ7-dafachronic acid (CHEBI:71556) is conjugate acid of (25S)-Δ7-dafachronate (CHEBI:71542) |
| Incoming Relation(s) |
| (25S)-Δ7-dafachronate (CHEBI:71542) is conjugate base of (25S)-Δ7-dafachronic acid (CHEBI:71556) |
| IUPAC Name |
|---|
| (25S)-3-oxo-5α-cholest-7-en-26-oic acid |
| Synonyms | Source |
|---|---|
| (25S)-3-keto-5α-cholest-7-en-26-oic acid | ChEBI |
| (25S),26-3-keto-7-cholestenoic acid | ChEBI |
| Δ7-dafachronic acid | ChEBI |
| Δ7-DA | ChEBI |
| dafa#2 | ChEBI |
| (5α,25S)-3-oxocholest-7-en-26-oic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| WO2007103508 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11170956 | Reaxys |
| CAS:949004-12-0 | SMID |
| Citations |
|---|