EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25NO5 |
| Net Charge | 0 |
| Average Mass | 407.466 |
| Monoisotopic Mass | 407.17327 |
| SMILES | N[C@@]1(C(=O)c2ccccc2)[C@H](c2ccccc2)[C@H]2CC(OC(=O)CCC(=O)O)[C@@H]1C2 |
| InChI | InChI=1S/C24H25NO5/c25-24(23(29)16-9-5-2-6-10-16)18-13-17(22(24)15-7-3-1-4-8-15)14-19(18)30-21(28)12-11-20(26)27/h1-10,17-19,22H,11-14,25H2,(H,26,27)/t17-,18+,19?,22-,24-/m1/s1 |
| InChIKey | YYUSZVUKKRMJFD-HAHIRZQVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-{[6-endo-amino-6-exo-benzoyl-5-exo-phenylnorbornan-2-yl]oxy}-4-oxobutanoic acid (CHEBI:71549) has functional parent succinic acid (CHEBI:15741) |
| 4-{[6-endo-amino-6-exo-benzoyl-5-exo-phenylnorbornan-2-yl]oxy}-4-oxobutanoic acid (CHEBI:71549) has parent hydride norbornane (CHEBI:71546) |
| 4-{[6-endo-amino-6-exo-benzoyl-5-exo-phenylnorbornan-2-yl]oxy}-4-oxobutanoic acid (CHEBI:71549) is a aromatic ketone (CHEBI:76224) |
| 4-{[6-endo-amino-6-exo-benzoyl-5-exo-phenylnorbornan-2-yl]oxy}-4-oxobutanoic acid (CHEBI:71549) is a dicarboxylic acid monoester (CHEBI:36244) |
| 4-{[6-endo-amino-6-exo-benzoyl-5-exo-phenylnorbornan-2-yl]oxy}-4-oxobutanoic acid (CHEBI:71549) is a hemisuccinate (CHEBI:138979) |
| 4-{[6-endo-amino-6-exo-benzoyl-5-exo-phenylnorbornan-2-yl]oxy}-4-oxobutanoic acid (CHEBI:71549) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 4-{[(1R,2S,4R,5S,6S)-6-amino-6-benzoyl-5-phenylbicyclo[2.2.1]hept-2-yl]oxy}-4-oxobutanoic acid |
| Citations |
|---|