EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12CC[C@]3(C)CCC[C@@H](C)[C@]3(C1)OC2(C)C |
| InChI | InChI=1S/C15H26O/c1-11-6-5-8-14(4)9-7-12-10-15(11,14)16-13(12,2)3/h11-12H,5-10H2,1-4H3/t11-,12-,14+,15+/m1/s1 |
| InChIKey | HVAVUZLEYSAYGE-UXOAXIEHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroagarofuran (CHEBI:71547) has role metabolite (CHEBI:25212) |
| dihydroagarofuran (CHEBI:71547) is a bridged compound (CHEBI:35990) |
| dihydroagarofuran (CHEBI:71547) is a cyclic ether (CHEBI:37407) |
| dihydroagarofuran (CHEBI:71547) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| dihydroagarofuran (CHEBI:71547) is a organic heterotricyclic compound (CHEBI:26979) |
| Incoming Relation(s) |
| dihydroagarofuran sesquiterpenoid (CHEBI:71548) has parent hydride dihydroagarofuran (CHEBI:71547) |
| IUPAC Name |
|---|
| (3R,5aS,9R,9aS)-2,2,5a,9-tetramethyloctahydro-2H-3,9a-methano-1-benzoxepine |
| Synonym | Source |
|---|---|
| dihydro-β-agarofuran | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1423249 | Reaxys |
| Citations |
|---|