EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O8 |
| Net Charge | 0 |
| Average Mass | 388.372 |
| Monoisotopic Mass | 388.11582 |
| SMILES | C[C@@H](O)CCC[C@H](O)c1c(O)cc2c(c1O)C(=O)c1c(O)cc(O)cc1C2=O |
| InChI | InChI=1S/C20H20O8/c1-8(21)3-2-4-12(23)17-14(25)7-11-16(20(17)28)19(27)15-10(18(11)26)5-9(22)6-13(15)24/h5-8,12,21-25,28H,2-4H2,1H3/t8-,12+/m1/s1 |
| InChIKey | GGNDESPZSKTNHV-PELKAZGASA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1'S,5'R)-5'-hydroxyaverantin (CHEBI:71536) has role fungal metabolite (CHEBI:76946) |
| (1'S,5'R)-5'-hydroxyaverantin (CHEBI:71536) is a polyketide (CHEBI:26188) |
| (1'S,5'R)-5'-hydroxyaverantin (CHEBI:71536) is a polyphenol (CHEBI:26195) |
| (1'S,5'R)-5'-hydroxyaverantin (CHEBI:71536) is a tetrahydroxyanthraquinone (CHEBI:37496) |
| IUPAC Name |
|---|
| 2-[(1S,5R)-1,5-dihydroxyhexyl]-1,3,6,8-tetrahydroxy-9,10-anthraquinone |
| UniProt Name | Source |
|---|---|
| (1'S,5'R)-5'-hydroxyaverantin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-10165 | MetaCyc |
| Citations |
|---|