EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O4 |
| Net Charge | 0 |
| Average Mass | 306.402 |
| Monoisotopic Mass | 306.18311 |
| SMILES | CC1(C)CC(c2ccc(OCCCCCC(=O)O)cc2)CO1 |
| InChI | InChI=1S/C18H26O4/c1-18(2)12-15(13-22-18)14-7-9-16(10-8-14)21-11-5-3-4-6-17(19)20/h7-10,15H,3-6,11-13H2,1-2H3,(H,19,20) |
| InChIKey | XCOQKBFJVUFNGL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[4-(5,5-dimethyltetrahydrofuran-3-yl)phenoxy]hexanoic acid (CHEBI:71528) is a aromatic ether (CHEBI:35618) |
| 6-[4-(5,5-dimethyltetrahydrofuran-3-yl)phenoxy]hexanoic acid (CHEBI:71528) is a monocarboxylic acid (CHEBI:25384) |
| Synonym | Source |
|---|---|
| 6-[4-(5,5-dimethyltetrahydrofuran-3-yl)phenoxy]hexanoic acid | ChEBI |
| Citations |
|---|