EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N10O12P2 |
| Net Charge | -2 |
| Average Mass | 656.402 |
| Monoisotopic Mass | 656.09049 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)([O-])O[C@H]3[C@@H](O)[C@H](n4cnc5c(N)ncnc54)O[C@@H]3COP(=O)([O-])O[C@H]2[C@H]1O |
| InChI | InChI=1S/C20H24N10O12P2/c21-15-9-17(25-3-23-15)29(5-27-9)19-11(31)13-7(39-19)1-37-43(33,34)42-14-8(2-38-44(35,36)41-13)40-20(12(14)32)30-6-28-10-16(22)24-4-26-18(10)30/h3-8,11-14,19-20,31-32H,1-2H2,(H,33,34)(H,35,36)(H2,21,23,25)(H2,22,24,26)/p-2/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1 |
| InChIKey | PDXMFTWFFKBFIN-XPWFQUROSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclic di-AMP(2−) (CHEBI:71500) is a organophosphate oxoanion (CHEBI:58945) |
| cyclic di-AMP(2−) (CHEBI:71500) is conjugate base of cyclic di-AMP (CHEBI:71578) |
| Incoming Relation(s) |
| cyclic di-AMP (CHEBI:71578) is conjugate acid of cyclic di-AMP(2−) (CHEBI:71500) |
| Synonyms | Source |
|---|---|
| cyclic di-3',5'-guanylate(2−) | ChEBI |
| 3',5'-cyclic di-AMP(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 3',3'-c-di-AMP | UniProt |