EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N5O20P5 |
| Net Charge | -7 |
| Average Mass | 676.083 |
| Monoisotopic Mass | 675.87239 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])[C@@H](OP(=O)([O-])OP(=O)([O-])[O-])[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H18N5O20P5/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6(32-39(26,27)33-36(18,19)20)3(31-9)1-30-38(24,25)35-40(28,29)34-37(21,22)23/h2-3,5-6,9,16H,1H2,(H,24,25)(H,26,27)(H,28,29)(H2,18,19,20)(H2,21,22,23)(H3,11,13,14,17)/p-7/t3-,5-,6-,9-/m1/s1 |
| InChIKey | KCPMACXZAITQAX-UUOKFMHZSA-G |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanosine 3'-diphosphate 5'-triphosphate(7−) (CHEBI:71477) is a ribonucleoside triphosphate oxoanion (CHEBI:59724) |
| guanosine 3'-diphosphate 5'-triphosphate(7−) (CHEBI:71477) is conjugate base of guanosine 3'-diphosphate 5'-triphosphate hexaanion (CHEBI:142410) |
| Incoming Relation(s) |
| guanosine 3'-diphosphate 5'-triphosphate hexaanion (CHEBI:142410) is conjugate acid of guanosine 3'-diphosphate 5'-triphosphate(7−) (CHEBI:71477) |
| IUPAC Name |
|---|
| 3'-O-[(phosphonatooxy)phosphinato]-5'-O-({[(phosphonatooxy)phosphinato]oxy}phosphinato)guanosine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6888426 | Reaxys |