EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O3 |
| Net Charge | 0 |
| Average Mass | 454.695 |
| Monoisotopic Mass | 454.34470 |
| SMILES | [H][C@@]12C[C@](C)(C(=O)O)CC[C@]1(C)CC[C@]1(C)C3=CC[C@@]4([H])C(C)(C)[C@@H](O)CC[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C30H46O3/c1-25(2)21-9-8-20-19(28(21,5)12-11-23(25)31)10-13-30(7)22-18-27(4,24(32)33)15-14-26(22,3)16-17-29(20,30)6/h8,10,21-23,31H,9,11-18H2,1-7H3,(H,32,33)/t21-,22+,23-,26+,27+,28+,29+,30-/m0/s1 |
| InChIKey | MKJSCJNRPNXEGW-FPLINDMSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D:C-friedoolean-7,9(11)-dien-3β-ol-29-oic acid (CHEBI:71468) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| D:C-friedoolean-7,9(11)-dien-3β-ol-29-oic acid (CHEBI:71468) is a pentacyclic triterpenoid (CHEBI:25872) |
| Incoming Relation(s) |
| 3-β-O-(E)-coumaroyl-D:C-friedooleana-7,9(11)-dien-29-oic acid (CHEBI:65663) has functional parent D:C-friedoolean-7,9(11)-dien-3β-ol-29-oic acid (CHEBI:71468) |
| IUPAC Name |
|---|
| (2R,4aS,6aS,8aR,10S,12aS,14aS,14bR)-10-hydroxy-2,4a,6a,9,9,12a,14a-heptamethyl-1,2,3,4,4a,5,6,6a,8,8a,9,10,11,12,12a,14,14a,14b-octadecahydropicene-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6616635 | Reaxys |