EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H39NO2 |
| Net Charge | 0 |
| Average Mass | 325.537 |
| Monoisotopic Mass | 325.29808 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCO |
| InChI | InChI=1S/C20H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h9-10,22H,2-8,11-19H2,1H3,(H,21,23)/b10-9- |
| InChIKey | BOWVQLFMWHZBEF-KTKRTIGZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.5.1.23 (ceramidase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the action of ceramidase (EC 3.5.1.23). PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleoyl ethanolamide (CHEBI:71466) has functional parent oleic acid (CHEBI:16196) |
| oleoyl ethanolamide (CHEBI:71466) has role EC 3.5.1.23 (ceramidase) inhibitor (CHEBI:71551) |
| oleoyl ethanolamide (CHEBI:71466) has role geroprotector (CHEBI:176497) |
| oleoyl ethanolamide (CHEBI:71466) has role PPARα agonist (CHEBI:70782) |
| oleoyl ethanolamide (CHEBI:71466) is a N-(long-chain-acyl)ethanolamine (CHEBI:15897) |
| oleoyl ethanolamide (CHEBI:71466) is a N-acylethanolamine 18:1 (CHEBI:134158) |
| oleoyl ethanolamide (CHEBI:71466) is a endocannabinoid (CHEBI:67197) |
| Incoming Relation(s) |
| N-oleoylethanolamine phosphate(2−) (CHEBI:145465) has part oleoyl ethanolamide (CHEBI:71466) |
| IUPAC Name |
|---|
| (9Z)-N-(2-hydroxyethyl)octadec-9-enamide |
| Synonyms | Source |
|---|---|
| oleoyl 1-ethanolamide | SUBMITTER |
| OEA | SUBMITTER |
| N-(hydroxyethyl)oleamide | LIPID MAPS |
| N-oleoyl ethanolamine | LIPID MAPS |
| N-(9Z-octadecenoyl)-ethanolamine | LIPID MAPS |
| N-(cis-9-octadecenoyl) ethanolamine | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| N-(9Z-octadecenoyl) ethanolamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMFA08040015 | LIPID MAPS |
| HMDB0002088 | HMDB |
| Oleoylethanolamide | Wikipedia |
| LSM-2694 | LINCS |
| DB16495 | DrugBank |
| CPD-20398 | MetaCyc |
| FDB022839 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2214880 | Reaxys |
| CAS:111-58-0 | ChemIDplus |
| Citations |
|---|