EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35NO2 |
| Net Charge | 0 |
| Average Mass | 297.483 |
| Monoisotopic Mass | 297.26678 |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)NCCO |
| InChI | InChI=1S/C18H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)19-16-17-20/h7-8,20H,2-6,9-17H2,1H3,(H,19,21)/b8-7- |
| InChIKey | WFRLANWAASSSFV-FPLPWBNLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmitoleoyl ethanolamide (CHEBI:71465) has functional parent palmitoleic acid (CHEBI:28716) |
| palmitoleoyl ethanolamide (CHEBI:71465) has role anti-inflammatory agent (CHEBI:67079) |
| palmitoleoyl ethanolamide (CHEBI:71465) is a N-acylethanolamine 16:1 (CHEBI:134156) |
| palmitoleoyl ethanolamide (CHEBI:71465) is a endocannabinoid (CHEBI:67197) |
| IUPAC Name |
|---|
| (9Z)-N-(2-hydroxyethyl)hexadec-9-enamide |
| Synonyms | Source |
|---|---|
| (Z)-hexadec-9-enoyl ethanolamide | ChEBI |
| POEA | SUBMITTER |
| N-(9Z-hexadecenoyl)-ethanolamine | LIPID MAPS |
| Palmitoleoyl-EA | LIPID MAPS |
| N-(2-hydroxyethyl)palmitoleylamide | ChEBI |
| UniProt Name | Source |
|---|---|
| N-(9Z-hexadecenoyl) ethanolamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMFA08040043 | LIPID MAPS |
| HMDB0013648 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14807297 | Reaxys |
| Citations |
|---|