EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H37NO2 |
| Net Charge | 0 |
| Average Mass | 299.499 |
| Monoisotopic Mass | 299.28243 |
| SMILES | CCCCCCCCCCCCCCCC(=O)NCCO |
| InChI | InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)19-16-17-20/h20H,2-17H2,1H3,(H,19,21) |
| InChIKey | HXYVTAGFYLMHSO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| Applications: | anti-inflammatory drug A substance that reduces or suppresses inflammation. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anticonvulsant A drug used to prevent seizures or reduce their severity. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmitoyl ethanolamide (CHEBI:71464) has functional parent hexadecanoic acid (CHEBI:15756) |
| palmitoyl ethanolamide (CHEBI:71464) has role anti-inflammatory drug (CHEBI:35472) |
| palmitoyl ethanolamide (CHEBI:71464) has role anticonvulsant (CHEBI:35623) |
| palmitoyl ethanolamide (CHEBI:71464) has role antihypertensive agent (CHEBI:35674) |
| palmitoyl ethanolamide (CHEBI:71464) has role neuroprotective agent (CHEBI:63726) |
| palmitoyl ethanolamide (CHEBI:71464) is a N-(long-chain-acyl)ethanolamine (CHEBI:15897) |
| palmitoyl ethanolamide (CHEBI:71464) is a N-(saturated fatty acyl)ethanolamine (CHEBI:85283) |
| palmitoyl ethanolamide (CHEBI:71464) is a endocannabinoid (CHEBI:67197) |
| IUPAC Name |
|---|
| N-(2-hydroxyethyl)hexadecanamide |
| INNs | Source |
|---|---|
| palmidrol | ChemIDplus |
| palmidrolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Anandamide (16:0) | LIPID MAPS |
| hexadecanoyl ethanolamide | SUBMITTER |
| Hydroxyethylpalmitamide | ChemIDplus |
| Monoethanolamine palmitic acid amide | ChemIDplus |
| N-(2-Hydroxyethyl)palmitamide | ChemIDplus |
| N-palmitoylethanolamine | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| N-hexadecanoylethanolamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2045 | DrugCentral |
| C16512 | KEGG COMPOUND |
| CA2738117 | Patent |
| D08328 | KEGG DRUG |
| EP2276461 | Patent |
| HMDB0002100 | HMDB |
| LMFA08040013 | LIPID MAPS |
| LSM-3518 | LINCS |
| Palmitoylethanolamide | Wikipedia |
| US2011046225 | Patent |
| US2011171313 | Patent |
| WO2009133574 | Patent |
| WO2011027373 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1789716 | Reaxys |
| CAS:544-31-0 | ChemIDplus |
| CAS:544-31-0 | KEGG COMPOUND |
| Citations |
|---|