EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H37NO2 |
| Net Charge | 0 |
| Average Mass | 299.499 |
| Monoisotopic Mass | 299.28243 |
| SMILES | CCCCCCCCCCCCCCCC(=O)NCCO |
| InChI | InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)19-16-17-20/h20H,2-17H2,1H3,(H,19,21) |
| InChIKey | HXYVTAGFYLMHSO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. anticonvulsant A drug used to prevent seizures or reduce their severity. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmitoyl ethanolamide (CHEBI:71464) has functional parent hexadecanoic acid (CHEBI:15756) |
| palmitoyl ethanolamide (CHEBI:71464) has role analgesic (CHEBI:35480) |
| palmitoyl ethanolamide (CHEBI:71464) has role anti-inflammatory drug (CHEBI:35472) |
| palmitoyl ethanolamide (CHEBI:71464) has role anticonvulsant (CHEBI:35623) |
| palmitoyl ethanolamide (CHEBI:71464) has role antihypertensive agent (CHEBI:35674) |
| palmitoyl ethanolamide (CHEBI:71464) has role antipsychotic agent (CHEBI:35476) |
| palmitoyl ethanolamide (CHEBI:71464) has role antiviral agent (CHEBI:22587) |
| palmitoyl ethanolamide (CHEBI:71464) has role neuroprotective agent (CHEBI:63726) |
| palmitoyl ethanolamide (CHEBI:71464) is a N-(long-chain-acyl)ethanolamine (CHEBI:15897) |
| palmitoyl ethanolamide (CHEBI:71464) is a N-(saturated fatty acyl)ethanolamine (CHEBI:85283) |
| palmitoyl ethanolamide (CHEBI:71464) is a endocannabinoid (CHEBI:67197) |
| IUPAC Name |
|---|
| N-(2-hydroxyethyl)hexadecanamide |
| INNs | Source |
|---|---|
| palmidrol | ChemIDplus |
| palmidrolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| AM 3112 | ChEMBL |
| Anandamide (16:0) | LIPID MAPS |
| FSD-201 | ChEMBL |
| hexadecanoyl ethanolamide | SUBMITTER |
| Hydroxyethylpalmitamide | ChemIDplus |
| Impulsin | ChEMBL |
| Brand Name | Source |
|---|---|
| Palmidrol component of sci-110 palmitoylethanolamide | ChEMBL |
| UniProt Name | Source |
|---|---|
| N-hexadecanoylethanolamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 2045 | DrugCentral |
| C16512 | KEGG COMPOUND |
| CA2738117 | Patent |
| D08328 | KEGG DRUG |
| EP2276461 | Patent |
| HMDB0002100 | HMDB |
| LMFA08040013 | LIPID MAPS |
| LSM-3518 | LINCS |
| Palmitoylethanolamide | Wikipedia |
| US2011046225 | Patent |
| US2011171313 | Patent |
| WO2009133574 | Patent |
| WO2011027373 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1789716 | Reaxys |
| CAS:544-31-0 | KEGG COMPOUND |
| CAS:544-31-0 | ChemIDplus |
| Citations |
|---|