EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O9 |
| Net Charge | 0 |
| Average Mass | 268.218 |
| Monoisotopic Mass | 268.07943 |
| SMILES | [H][C@@]1([C@H](O)[C@H](O)CO)O[C@@](O)(C(=O)O)C[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[Aad21122h-2a_2-6]/1/ |
| InChI | InChI=1S/C9H16O9/c10-2-4(12)6(14)7-5(13)3(11)1-9(17,18-7)8(15)16/h3-7,10-14,17H,1-2H2,(H,15,16)/t3-,4+,5+,6+,7+,9+/m0/s1 |
| InChIKey | CLRLHXKNIYJWAW-LSRLBZCKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deamino-α-neuraminic acid (CHEBI:71432) is a deaminoneuraminic acid (CHEBI:71429) |
| deamino-α-neuraminic acid (CHEBI:71432) is conjugate acid of deamino-α-neuraminate(1−) (CHEBI:232096) |
| Incoming Relation(s) |
| oligo(α2→8KDN) (DP = 2—7) (CHEBI:142634) has functional parent deamino-α-neuraminic acid (CHEBI:71432) |
| deamino-α-neuraminate(1−) (CHEBI:232096) is conjugate base of deamino-α-neuraminic acid (CHEBI:71432) |
| IUPAC Name |
|---|
| 3-deoxy-D-glycero-α-D-galacto-non-2-ulopyranosonic acid |
| Synonyms | Source |
|---|---|
| 2-keto-3-deoxy-D-glycero-α-D-galacto-nononic acid | ChEBI |
| (6R)-3-deoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]-β-L-threo-hex-2-ulopyranosonic acid | IUPAC |
| KDN-α | ChEBI |
| KDNα | ChEBI |
| α-KDN | ChEBI |
| αKDN | ChEBI |
| Citations |
|---|